C15H14ClN5O — CID 122549538
11-chloro-12-(2-methoxypyrimidin-5-yl)-1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),8,10,12-tetraene (PubChem CID 122549538) has the molecular formula C15H14ClN5O and a molecular weight of 315.76 g/mol. Its IUPAC name is 11-chloro-12-(2-methoxypyrimidin-5-yl)-1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),8,10,12-tetraene.
| Compound Name | 11-chloro-12-(2-methoxypyrimidin-5-yl)-1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),8,10,12-tetraene |
|---|---|
| PubChem CID | 122549538 |
| Molecular Formula | C15H14ClN5O |
| Molecular Weight | 315.76 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | 11-chloro-12-(2-methoxypyrimidin-5-yl)-1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),8,10,12-tetraene |
| SMILES | COc1ncc(-c2cn3c4c(nc3cc2Cl)CCCN4)cn1 |
| InChI | InChI=1S/C15H14ClN5O/c1-22-15-18-6-9(7-19-15)10-8-21-13(5-11(10)16)20-12-3-2-4-17-14(12)21/h5-8,17H,2-4H2,1H3 |
| InChIKey | AZLKJSVMSLLIRC-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 64.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.76 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |