About [4-(2,3-difluoro-4-methoxycyclohexyl)-2,3-difluorocyclohexyl] 4-methylcyclohexane-1-carboxylate
[4-(2,3-difluoro-4-methoxycyclohexyl)-2,3-difluorocyclohexyl] 4-methylcyclohexane-1-carboxylate (PubChem CID 122549571) has the molecular formula C21H32F4O3
and a molecular weight of 408.48 g/mol. Its IUPAC name is [4-(2,3-difluoro-4-methoxycyclohexyl)-2,3-difluorocyclohexyl] 4-methylcyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | [4-(2,3-difluoro-4-methoxycyclohexyl)-2,3-difluorocyclohexyl] 4-methylcyclohexane-1-carboxylate |
| PubChem CID | 122549571 |
| Molecular Formula | C21H32F4O3 |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | [4-(2,3-difluoro-4-methoxycyclohexyl)-2,3-difluorocyclohexyl] 4-methylcyclohexane-1-carboxylate |
| SMILES | COC1CCC(C2CCC(OC(=O)C3CCC(C)CC3)C(F)C2F)C(F)C1F |
| InChI | InChI=1S/C21H32F4O3/c1-11-3-5-12(6-4-11)21(26)28-16-10-8-14(18(23)20(16)25)13-7-9-15(27-2)19(24)17(13)22/h11-20H,3-10H2,1-2H3 |
| InChIKey | OYEHEIWNCYKMPA-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [4-(2,3-difluoro-4-methoxycyclohexyl)-2,3-difluorocyclohexyl] 4-methylcyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(2,3-difluoro-4-methoxycyclohexyl)-2,3-difluorocyclohexyl] 4-methylcyclohexane-1-carboxylate?
The IUPAC name of [4-(2,3-difluoro-4-methoxycyclohexyl)-2,3-difluorocyclohexyl] 4-methylcyclohexane-1-carboxylate (CID 122549571) is [4-(2,3-difluoro-4-methoxycyclohexyl)-2,3-difluorocyclohexyl] 4-methylcyclohexane-1-carboxylate.
What is the SMILES notation for [4-(2,3-difluoro-4-methoxycyclohexyl)-2,3-difluorocyclohexyl] 4-methylcyclohexane-1-carboxylate?
The canonical SMILES for [4-(2,3-difluoro-4-methoxycyclohexyl)-2,3-difluorocyclohexyl] 4-methylcyclohexane-1-carboxylate is COC1CCC(C2CCC(OC(=O)C3CCC(C)CC3)C(F)C2F)C(F)C1F.
What is the InChIKey of [4-(2,3-difluoro-4-methoxycyclohexyl)-2,3-difluorocyclohexyl] 4-methylcyclohexane-1-carboxylate?
The InChIKey is OYEHEIWNCYKMPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H32F4O3/c1-11-3-5-12(6-4-11)21(26)28-16-10-8-14(18(23)20(16)25)13-7-9-15(27-2)19(24)17(13)22/h11-20H,3-10H2,1-2H3.
What are the key properties of [4-(2,3-difluoro-4-methoxycyclohexyl)-2,3-difluorocyclohexyl] 4-methylcyclohexane-1-carboxylate?
[4-(2,3-difluoro-4-methoxycyclohexyl)-2,3-difluorocyclohexyl] 4-methylcyclohexane-1-carboxylate has a molecular weight of 408.48 g/mol, XLogP of 4.91, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2,3-difluoro-4-methoxycyclohexyl)-2,3-difluorocyclohexyl] 4-methylcyclohexane-1-carboxylate is sourced from PubChem (CID 122549571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).