C35H42N5O2S+ — CID 122549720
3-[3-[3-[2-[5-(5-octyl-1,3-benzoxazol-2-yl)thiophen-2-yl]-1,3-benzoxazol-5-yl]propyl]imidazol-3-ium-1-yl]propan-1-amine (PubChem CID 122549720) has the molecular formula C35H42N5O2S+ and a molecular weight of 596.82 g/mol. Its IUPAC name is 3-[3-[3-[2-[5-(5-octyl-1,3-benzoxazol-2-yl)thiophen-2-yl]-1,3-benzoxazol-5-yl]propyl]imidazol-3-ium-1-yl]propan-1-amine.
| Compound Name | 3-[3-[3-[2-[5-(5-octyl-1,3-benzoxazol-2-yl)thiophen-2-yl]-1,3-benzoxazol-5-yl]propyl]imidazol-3-ium-1-yl]propan-1-amine |
|---|---|
| PubChem CID | 122549720 |
| Molecular Formula | C35H42N5O2S+ |
| Molecular Weight | 596.82 g/mol |
| Exact Mass | 596.31 |
| IUPAC Name | 3-[3-[3-[2-[5-(5-octyl-1,3-benzoxazol-2-yl)thiophen-2-yl]-1,3-benzoxazol-5-yl]propyl]imidazol-3-ium-1-yl]propan-1-amine |
| SMILES | CCCCCCCCc1ccc2oc(-c3ccc(-c4nc5cc(CCC[n+]6ccn(CCCN)c6)ccc5o4)s3)nc2c1 |
| InChI | InChI=1S/C35H42N5O2S/c1-2-3-4-5-6-7-10-26-12-14-30-28(23-26)37-34(41-30)32-16-17-33(43-32)35-38-29-24-27(13-15-31(29)42-35)11-8-19-39-21-22-40(25-39)20-9-18-36/h12-17,21-25H,2-11,18-20,36H2,1H3/q+1 |
| InChIKey | KYQFCWUPZKOPOU-UHFFFAOYSA-N |
| XLogP | 8.34 |
| TPSA | 86.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.82 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|