C27H36IN3O4 — CID 122549764
2-methylpropyl (2S,3R)-2-[[1-ethyl-2-[(2E,4Z)-7-iodo-5-methyl-6-oxoocta-2,4,7-trien-3-yl]benzimidazol-5-yl]methylamino]-3-hydroxybutanoate (PubChem CID 122549764) has the molecular formula C27H36IN3O4 and a molecular weight of 593.51 g/mol. Its IUPAC name is 2-methylpropyl (2S,3R)-2-[[1-ethyl-2-[(2E,4Z)-7-iodo-5-methyl-6-oxoocta-2,4,7-trien-3-yl]benzimidazol-5-yl]methylamino]-3-hydroxybutanoate.
| Compound Name | 2-methylpropyl (2S,3R)-2-[[1-ethyl-2-[(2E,4Z)-7-iodo-5-methyl-6-oxoocta-2,4,7-trien-3-yl]benzimidazol-5-yl]methylamino]-3-hydroxybutanoate |
|---|---|
| PubChem CID | 122549764 |
| Molecular Formula | C27H36IN3O4 |
| Molecular Weight | 593.51 g/mol |
| Exact Mass | 593.18 |
| IUPAC Name | 2-methylpropyl (2S,3R)-2-[[1-ethyl-2-[(2E,4Z)-7-iodo-5-methyl-6-oxoocta-2,4,7-trien-3-yl]benzimidazol-5-yl]methylamino]-3-hydroxybutanoate |
| SMILES | C=C(I)C(=O)/C(C)=C\C(=C/C)c1nc2cc(CN[C@H](C(=O)OCC(C)C)[C@@H](C)O)ccc2n1CC |
| InChI | InChI=1S/C27H36IN3O4/c1-8-21(12-17(5)25(33)18(6)28)26-30-22-13-20(10-11-23(22)31(26)9-2)14-29-24(19(7)32)27(34)35-15-16(3)4/h8,10-13,16,19,24,29,32H,6,9,14-15H2,1-5,7H3/b17-12-,21-8+/t19-,24+/m1/s1 |
| InChIKey | APJZFRJDXSDXHW-MBXQWFMSSA-N |
| XLogP | 4.96 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.51 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|