C17H33NO5 — CID 122549823
N-[[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]methyl]-N-methyldecanamide (PubChem CID 122549823) has the molecular formula C17H33NO5 and a molecular weight of 331.45 g/mol. Its IUPAC name is N-[[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]methyl]-N-methyldecanamide.
| Compound Name | N-[[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]methyl]-N-methyldecanamide |
|---|---|
| PubChem CID | 122549823 |
| Molecular Formula | C17H33NO5 |
| Molecular Weight | 331.45 g/mol |
| Exact Mass | 331.24 |
| IUPAC Name | N-[[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]methyl]-N-methyldecanamide |
| SMILES | CCCCCCCCCC(=O)N(C)CC1OC(CO)C(O)C1O |
| InChI | InChI=1S/C17H33NO5/c1-3-4-5-6-7-8-9-10-15(20)18(2)11-13-16(21)17(22)14(12-19)23-13/h13-14,16-17,19,21-22H,3-12H2,1-2H3 |
| InChIKey | PWGYXMSWNMNGPF-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.45 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|