C21H35ClN7+ — CID 122549857
N'-[5-(chloroamino)pentyl]-N'-[4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]phenyl]pentane-1,5-diamine (PubChem CID 122549857) has the molecular formula C21H35ClN7+ and a molecular weight of 421.01 g/mol. Its IUPAC name is N'-[5-(chloroamino)pentyl]-N'-[4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]phenyl]pentane-1,5-diamine.
| Compound Name | N'-[5-(chloroamino)pentyl]-N'-[4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]phenyl]pentane-1,5-diamine |
|---|---|
| PubChem CID | 122549857 |
| Molecular Formula | C21H35ClN7+ |
| Molecular Weight | 421.01 g/mol |
| Exact Mass | 420.26 |
| IUPAC Name | N'-[5-(chloroamino)pentyl]-N'-[4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]phenyl]pentane-1,5-diamine |
| SMILES | Cn1cc[n+](C)c1/N=N/c1ccc(N(CCCCCN)CCCCCNCl)cc1 |
| InChI | InChI=1S/C21H35ClN7/c1-27-17-18-28(2)21(27)26-25-19-9-11-20(12-10-19)29(15-7-3-5-13-23)16-8-4-6-14-24-22/h9-12,17-18,24H,3-8,13-16,23H2,1-2H3/q+1 |
| InChIKey | HIYVBWRETZSSBE-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 74.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.01 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|