C28H10F8N4S6 — CID 122549922
2,8-bis[5-[3-fluoro-4-(trifluoromethylsulfanyl)phenyl]thiophen-2-yl]-5λ4,11-dithia-4,6,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-1(12),2,4,5,7,9-hexaene (PubChem CID 122549922) has the molecular formula C28H10F8N4S6 and a molecular weight of 746.80 g/mol. Its IUPAC name is 2,8-bis[5-[3-fluoro-4-(trifluoromethylsulfanyl)phenyl]thiophen-2-yl]-5λ4,11-dithia-4,6,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-1(12),2,4,5,7,9-hexaene.
| Compound Name | 2,8-bis[5-[3-fluoro-4-(trifluoromethylsulfanyl)phenyl]thiophen-2-yl]-5λ4,11-dithia-4,6,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-1(12),2,4,5,7,9-hexaene |
|---|---|
| PubChem CID | 122549922 |
| Molecular Formula | C28H10F8N4S6 |
| Molecular Weight | 746.80 g/mol |
| Exact Mass | 745.91 |
| IUPAC Name | 2,8-bis[5-[3-fluoro-4-(trifluoromethylsulfanyl)phenyl]thiophen-2-yl]-5λ4,11-dithia-4,6,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-1(12),2,4,5,7,9-hexaene |
| SMILES | Fc1cc(-c2ccc(-c3c4c(c(-c5ccc(-c6ccc(SC(F)(F)F)c(F)c6)s5)c5nsnc35)N=S=N4)s2)ccc1SC(F)(F)F |
| InChI | InChI=1S/C28H10F8N4S6/c29-13-9-11(1-3-17(13)43-27(31,32)33)15-5-7-19(41-15)21-23-25(39-45-37-23)22(26-24(21)38-46-40-26)20-8-6-16(42-20)12-2-4-18(14(30)10-12)44-28(34,35)36/h1-10H |
| InChIKey | KHCFXCHJRDLWPG-UHFFFAOYSA-N |
| XLogP | 12.71 |
| TPSA | 50.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.80 |
| LogP ≤ 5 | 12.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |