About 1-chloroethyl (3,5,6-trimethylpyrazin-2-yl)methyl carbonate
1-chloroethyl (3,5,6-trimethylpyrazin-2-yl)methyl carbonate (PubChem CID 122550013) has the molecular formula C11H15ClN2O3
and a molecular weight of 258.70 g/mol. Its IUPAC name is 1-chloroethyl (3,5,6-trimethylpyrazin-2-yl)methyl carbonate.
Molecular Properties
| Compound Name | 1-chloroethyl (3,5,6-trimethylpyrazin-2-yl)methyl carbonate |
| PubChem CID | 122550013 |
| Molecular Formula | C11H15ClN2O3 |
| Molecular Weight | 258.70 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | 1-chloroethyl (3,5,6-trimethylpyrazin-2-yl)methyl carbonate |
| SMILES | Cc1nc(C)c(COC(=O)OC(C)Cl)nc1C |
| InChI | InChI=1S/C11H15ClN2O3/c1-6-7(2)14-10(8(3)13-6)5-16-11(15)17-9(4)12/h9H,5H2,1-4H3 |
| InChIKey | ZZRNMDKAVNTBEN-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.70 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-chloroethyl (3,5,6-trimethylpyrazin-2-yl)methyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloroethyl (3,5,6-trimethylpyrazin-2-yl)methyl carbonate?
The IUPAC name of 1-chloroethyl (3,5,6-trimethylpyrazin-2-yl)methyl carbonate (CID 122550013) is 1-chloroethyl (3,5,6-trimethylpyrazin-2-yl)methyl carbonate.
What is the SMILES notation for 1-chloroethyl (3,5,6-trimethylpyrazin-2-yl)methyl carbonate?
The canonical SMILES for 1-chloroethyl (3,5,6-trimethylpyrazin-2-yl)methyl carbonate is Cc1nc(C)c(COC(=O)OC(C)Cl)nc1C.
What is the InChIKey of 1-chloroethyl (3,5,6-trimethylpyrazin-2-yl)methyl carbonate?
The InChIKey is ZZRNMDKAVNTBEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15ClN2O3/c1-6-7(2)14-10(8(3)13-6)5-16-11(15)17-9(4)12/h9H,5H2,1-4H3.
What are the key properties of 1-chloroethyl (3,5,6-trimethylpyrazin-2-yl)methyl carbonate?
1-chloroethyl (3,5,6-trimethylpyrazin-2-yl)methyl carbonate has a molecular weight of 258.70 g/mol, XLogP of 2.64, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloroethyl (3,5,6-trimethylpyrazin-2-yl)methyl carbonate is sourced from PubChem (CID 122550013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).