C14H21ClN2O3 — CID 122550015
(1-chloro-2,2-dimethylpropyl) (3,5,6-trimethylpyrazin-2-yl)methyl carbonate (PubChem CID 122550015) has the molecular formula C14H21ClN2O3 and a molecular weight of 300.79 g/mol. Its IUPAC name is (1-chloro-2,2-dimethylpropyl) (3,5,6-trimethylpyrazin-2-yl)methyl carbonate.
| Compound Name | (1-chloro-2,2-dimethylpropyl) (3,5,6-trimethylpyrazin-2-yl)methyl carbonate |
|---|---|
| PubChem CID | 122550015 |
| Molecular Formula | C14H21ClN2O3 |
| Molecular Weight | 300.79 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | (1-chloro-2,2-dimethylpropyl) (3,5,6-trimethylpyrazin-2-yl)methyl carbonate |
| SMILES | Cc1nc(C)c(COC(=O)OC(Cl)C(C)(C)C)nc1C |
| InChI | InChI=1S/C14H21ClN2O3/c1-8-9(2)17-11(10(3)16-8)7-19-13(18)20-12(15)14(4,5)6/h12H,7H2,1-6H3 |
| InChIKey | LFBORFDUBHIOJQ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.79 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|