C22H28O2 — CID 122550046
(9Z,11E)-11-(2-cyclopropylethynyl)-3-ethoxy-13-methylidenespiro[5.8]tetradeca-9,11-dien-14-one (PubChem CID 122550046) has the molecular formula C22H28O2 and a molecular weight of 324.46 g/mol. Its IUPAC name is (9Z,11E)-11-(2-cyclopropylethynyl)-3-ethoxy-13-methylidenespiro[5.8]tetradeca-9,11-dien-14-one.
| Compound Name | (9Z,11E)-11-(2-cyclopropylethynyl)-3-ethoxy-13-methylidenespiro[5.8]tetradeca-9,11-dien-14-one |
|---|---|
| PubChem CID | 122550046 |
| Molecular Formula | C22H28O2 |
| Molecular Weight | 324.46 g/mol |
| Exact Mass | 324.21 |
| IUPAC Name | (9Z,11E)-11-(2-cyclopropylethynyl)-3-ethoxy-13-methylidenespiro[5.8]tetradeca-9,11-dien-14-one |
| SMILES | C=C1/C=C(C#CC2CC2)\C=C/CCC2(CCC(OCC)CC2)C1=O |
| InChI | InChI=1S/C22H28O2/c1-3-24-20-11-14-22(15-12-20)13-5-4-6-19(10-9-18-7-8-18)16-17(2)21(22)23/h4,6,16,18,20H,2-3,5,7-8,11-15H2,1H3/b6-4-,19-16+ |
| InChIKey | LVOHNHXXVKGUCN-WAAFZMCHSA-N |
| XLogP | 4.77 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.46 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|