C36H38ClN5O6 — CID 122550396
7-[4-[(2S)-2-[[4-(aminomethyl)cyclohexanecarbonyl]amino]-3-[3-chloro-4-(methylcarbamoyl)anilino]-3-oxopropyl]phenyl]-6-methyl-4-oxo-1H-quinoline-3-carboxylic acid (PubChem CID 122550396) has the molecular formula C36H38ClN5O6 and a molecular weight of 672.18 g/mol. Its IUPAC name is 7-[4-[(2S)-2-[[4-(aminomethyl)cyclohexanecarbonyl]amino]-3-[3-chloro-4-(methylcarbamoyl)anilino]-3-oxopropyl]phenyl]-6-methyl-4-oxo-1H-quinoline-3-carboxylic acid.
| Compound Name | 7-[4-[(2S)-2-[[4-(aminomethyl)cyclohexanecarbonyl]amino]-3-[3-chloro-4-(methylcarbamoyl)anilino]-3-oxopropyl]phenyl]-6-methyl-4-oxo-1H-quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 122550396 |
| Molecular Formula | C36H38ClN5O6 |
| Molecular Weight | 672.18 g/mol |
| Exact Mass | 671.25 |
| IUPAC Name | 7-[4-[(2S)-2-[[4-(aminomethyl)cyclohexanecarbonyl]amino]-3-[3-chloro-4-(methylcarbamoyl)anilino]-3-oxopropyl]phenyl]-6-methyl-4-oxo-1H-quinoline-3-carboxylic acid |
| SMILES | CNC(=O)c1ccc(NC(=O)[C@H](Cc2ccc(-c3cc4[nH]cc(C(=O)O)c(=O)c4cc3C)cc2)NC(=O)C2CCC(CN)CC2)cc1Cl |
| InChI | InChI=1S/C36H38ClN5O6/c1-19-13-27-30(40-18-28(32(27)43)36(47)48)16-26(19)22-7-3-20(4-8-22)14-31(42-33(44)23-9-5-21(17-38)6-10-23)35(46)41-24-11-12-25(29(37)15-24)34(45)39-2/h3-4,7-8,11-13,15-16,18,21,23,31H,5-6,9-10,14,17,38H2,1-2H3,(H,39,45)(H,40,43)(H,41,46)(H,42,44)(H,47,48)/t21?,23?,31-/m0/s1 |
| InChIKey | LCMPWMFTZAUSIJ-SGSZRKLKSA-N |
| XLogP | 4.65 |
| TPSA | 183.48 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.18 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |