About 2-[(5R,6R)-3-ethyl-6-bicyclo[3.2.0]hept-3-enyl]ethanimine
2-[(5R,6R)-3-ethyl-6-bicyclo[3.2.0]hept-3-enyl]ethanimine (PubChem CID 122550534) has the molecular formula C11H17N
and a molecular weight of 163.26 g/mol. Its IUPAC name is 2-[(5R,6R)-3-ethyl-6-bicyclo[3.2.0]hept-3-enyl]ethanimine.
Molecular Properties
| Compound Name | 2-[(5R,6R)-3-ethyl-6-bicyclo[3.2.0]hept-3-enyl]ethanimine |
| PubChem CID | 122550534 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | 2-[(5R,6R)-3-ethyl-6-bicyclo[3.2.0]hept-3-enyl]ethanimine |
| SMILES | [H]/N=C/C[C@H]1CC2CC(CC)=C[C@H]21 |
| InChI | InChI=1S/C11H17N/c1-2-8-5-10-7-9(3-4-12)11(10)6-8/h4,6,9-12H,2-3,5,7H2,1H3/b12-4+/t9-,10?,11-/m0/s1 |
| InChIKey | NOISYOVBTOPOBD-OODHRRGOSA-N |
| XLogP | 3.02 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(5R,6R)-3-ethyl-6-bicyclo[3.2.0]hept-3-enyl]ethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5R,6R)-3-ethyl-6-bicyclo[3.2.0]hept-3-enyl]ethanimine?
The IUPAC name of 2-[(5R,6R)-3-ethyl-6-bicyclo[3.2.0]hept-3-enyl]ethanimine (CID 122550534) is 2-[(5R,6R)-3-ethyl-6-bicyclo[3.2.0]hept-3-enyl]ethanimine.
What is the SMILES notation for 2-[(5R,6R)-3-ethyl-6-bicyclo[3.2.0]hept-3-enyl]ethanimine?
The canonical SMILES for 2-[(5R,6R)-3-ethyl-6-bicyclo[3.2.0]hept-3-enyl]ethanimine is [H]/N=C/C[C@H]1CC2CC(CC)=C[C@H]21.
What is the InChIKey of 2-[(5R,6R)-3-ethyl-6-bicyclo[3.2.0]hept-3-enyl]ethanimine?
The InChIKey is NOISYOVBTOPOBD-OODHRRGOSA-N. The full InChI is InChI=1S/C11H17N/c1-2-8-5-10-7-9(3-4-12)11(10)6-8/h4,6,9-12H,2-3,5,7H2,1H3/b12-4+/t9-,10?,11-/m0/s1.
What are the key properties of 2-[(5R,6R)-3-ethyl-6-bicyclo[3.2.0]hept-3-enyl]ethanimine?
2-[(5R,6R)-3-ethyl-6-bicyclo[3.2.0]hept-3-enyl]ethanimine has a molecular weight of 163.26 g/mol, XLogP of 3.02, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5R,6R)-3-ethyl-6-bicyclo[3.2.0]hept-3-enyl]ethanimine is sourced from PubChem (CID 122550534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).