C12H20N6 — CID 122550550
(1S,5S,6S)-6-(aminomethyl)-3-ethyl-6-(2H-tetrazol-5-ylmethyl)bicyclo[3.2.0]hept-3-en-1-amine (PubChem CID 122550550) has the molecular formula C12H20N6 and a molecular weight of 248.33 g/mol. Its IUPAC name is (1S,5S,6S)-6-(aminomethyl)-3-ethyl-6-(2H-tetrazol-5-ylmethyl)bicyclo[3.2.0]hept-3-en-1-amine.
| Compound Name | (1S,5S,6S)-6-(aminomethyl)-3-ethyl-6-(2H-tetrazol-5-ylmethyl)bicyclo[3.2.0]hept-3-en-1-amine |
|---|---|
| PubChem CID | 122550550 |
| Molecular Formula | C12H20N6 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.17 |
| IUPAC Name | (1S,5S,6S)-6-(aminomethyl)-3-ethyl-6-(2H-tetrazol-5-ylmethyl)bicyclo[3.2.0]hept-3-en-1-amine |
| SMILES | CCC1=C[C@@H]2[C@](N)(C1)C[C@]2(CN)Cc1nn[nH]n1 |
| InChI | InChI=1S/C12H20N6/c1-2-8-3-9-11(7-13,6-12(9,14)4-8)5-10-15-17-18-16-10/h3,9H,2,4-7,13-14H2,1H3,(H,15,16,17,18)/t9-,11-,12-/m0/s1 |
| InChIKey | SPUOPMFQIHKHPD-DLOVCJGASA-N |
| XLogP | 0.14 |
| TPSA | 106.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|