About tert-butyl 3,5-dihydroxy-4-nitrobicyclo[2.2.2]octane-1-carboxylate
tert-butyl 3,5-dihydroxy-4-nitrobicyclo[2.2.2]octane-1-carboxylate (PubChem CID 122551099) has the molecular formula C13H21NO6
and a molecular weight of 287.31 g/mol. Its IUPAC name is tert-butyl 3,5-dihydroxy-4-nitrobicyclo[2.2.2]octane-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 3,5-dihydroxy-4-nitrobicyclo[2.2.2]octane-1-carboxylate |
| PubChem CID | 122551099 |
| Molecular Formula | C13H21NO6 |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | tert-butyl 3,5-dihydroxy-4-nitrobicyclo[2.2.2]octane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)C12CCC([N+](=O)[O-])(C(O)C1)C(O)C2 |
| InChI | InChI=1S/C13H21NO6/c1-11(2,3)20-10(17)12-4-5-13(14(18)19,8(15)6-12)9(16)7-12/h8-9,15-16H,4-7H2,1-3H3 |
| InChIKey | RJPQSJPWVDLBNX-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 109.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 3,5-dihydroxy-4-nitrobicyclo[2.2.2]octane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 3,5-dihydroxy-4-nitrobicyclo[2.2.2]octane-1-carboxylate?
The IUPAC name of tert-butyl 3,5-dihydroxy-4-nitrobicyclo[2.2.2]octane-1-carboxylate (CID 122551099) is tert-butyl 3,5-dihydroxy-4-nitrobicyclo[2.2.2]octane-1-carboxylate.
What is the SMILES notation for tert-butyl 3,5-dihydroxy-4-nitrobicyclo[2.2.2]octane-1-carboxylate?
The canonical SMILES for tert-butyl 3,5-dihydroxy-4-nitrobicyclo[2.2.2]octane-1-carboxylate is CC(C)(C)OC(=O)C12CCC([N+](=O)[O-])(C(O)C1)C(O)C2.
What is the InChIKey of tert-butyl 3,5-dihydroxy-4-nitrobicyclo[2.2.2]octane-1-carboxylate?
The InChIKey is RJPQSJPWVDLBNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21NO6/c1-11(2,3)20-10(17)12-4-5-13(14(18)19,8(15)6-12)9(16)7-12/h8-9,15-16H,4-7H2,1-3H3.
What are the key properties of tert-butyl 3,5-dihydroxy-4-nitrobicyclo[2.2.2]octane-1-carboxylate?
tert-butyl 3,5-dihydroxy-4-nitrobicyclo[2.2.2]octane-1-carboxylate has a molecular weight of 287.31 g/mol, XLogP of 0.64, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 3,5-dihydroxy-4-nitrobicyclo[2.2.2]octane-1-carboxylate is sourced from PubChem (CID 122551099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).