About tert-butyl 6-bromo-3-methyl-2-phenylquinoline-4-carboxylate
tert-butyl 6-bromo-3-methyl-2-phenylquinoline-4-carboxylate (PubChem CID 122551271) has the molecular formula C21H20BrNO2
and a molecular weight of 398.30 g/mol. Its IUPAC name is tert-butyl 6-bromo-3-methyl-2-phenylquinoline-4-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 6-bromo-3-methyl-2-phenylquinoline-4-carboxylate |
| PubChem CID | 122551271 |
| Molecular Formula | C21H20BrNO2 |
| Molecular Weight | 398.30 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | tert-butyl 6-bromo-3-methyl-2-phenylquinoline-4-carboxylate |
| SMILES | Cc1c(-c2ccccc2)nc2ccc(Br)cc2c1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H20BrNO2/c1-13-18(20(24)25-21(2,3)4)16-12-15(22)10-11-17(16)23-19(13)14-8-6-5-7-9-14/h5-12H,1-4H3 |
| InChIKey | BLBGJAJKJYEEFS-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 398.30 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl 6-bromo-3-methyl-2-phenylquinoline-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 6-bromo-3-methyl-2-phenylquinoline-4-carboxylate?
The IUPAC name of tert-butyl 6-bromo-3-methyl-2-phenylquinoline-4-carboxylate (CID 122551271) is tert-butyl 6-bromo-3-methyl-2-phenylquinoline-4-carboxylate.
What is the SMILES notation for tert-butyl 6-bromo-3-methyl-2-phenylquinoline-4-carboxylate?
The canonical SMILES for tert-butyl 6-bromo-3-methyl-2-phenylquinoline-4-carboxylate is Cc1c(-c2ccccc2)nc2ccc(Br)cc2c1C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl 6-bromo-3-methyl-2-phenylquinoline-4-carboxylate?
The InChIKey is BLBGJAJKJYEEFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20BrNO2/c1-13-18(20(24)25-21(2,3)4)16-12-15(22)10-11-17(16)23-19(13)14-8-6-5-7-9-14/h5-12H,1-4H3.
What are the key properties of tert-butyl 6-bromo-3-methyl-2-phenylquinoline-4-carboxylate?
tert-butyl 6-bromo-3-methyl-2-phenylquinoline-4-carboxylate has a molecular weight of 398.30 g/mol, XLogP of 5.93, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 6-bromo-3-methyl-2-phenylquinoline-4-carboxylate is sourced from PubChem (CID 122551271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).