About 2-[(2S)-4-methylidenepyrrolidin-2-yl]-1,3-oxazolidine
2-[(2S)-4-methylidenepyrrolidin-2-yl]-1,3-oxazolidine (PubChem CID 122551448) has the molecular formula C8H14N2O
and a molecular weight of 154.21 g/mol. Its IUPAC name is 2-[(2S)-4-methylidenepyrrolidin-2-yl]-1,3-oxazolidine.
Molecular Properties
| Compound Name | 2-[(2S)-4-methylidenepyrrolidin-2-yl]-1,3-oxazolidine |
| PubChem CID | 122551448 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | 2-[(2S)-4-methylidenepyrrolidin-2-yl]-1,3-oxazolidine |
| SMILES | C=C1CN[C@H](C2NCCO2)C1 |
| InChI | InChI=1S/C8H14N2O/c1-6-4-7(10-5-6)8-9-2-3-11-8/h7-10H,1-5H2/t7-,8?/m0/s1 |
| InChIKey | SHPOSPJUPBHYPE-JAMMHHFISA-N |
| XLogP | -0.15 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2S)-4-methylidenepyrrolidin-2-yl]-1,3-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2S)-4-methylidenepyrrolidin-2-yl]-1,3-oxazolidine?
The IUPAC name of 2-[(2S)-4-methylidenepyrrolidin-2-yl]-1,3-oxazolidine (CID 122551448) is 2-[(2S)-4-methylidenepyrrolidin-2-yl]-1,3-oxazolidine.
What is the SMILES notation for 2-[(2S)-4-methylidenepyrrolidin-2-yl]-1,3-oxazolidine?
The canonical SMILES for 2-[(2S)-4-methylidenepyrrolidin-2-yl]-1,3-oxazolidine is C=C1CN[C@H](C2NCCO2)C1.
What is the InChIKey of 2-[(2S)-4-methylidenepyrrolidin-2-yl]-1,3-oxazolidine?
The InChIKey is SHPOSPJUPBHYPE-JAMMHHFISA-N. The full InChI is InChI=1S/C8H14N2O/c1-6-4-7(10-5-6)8-9-2-3-11-8/h7-10H,1-5H2/t7-,8?/m0/s1.
What are the key properties of 2-[(2S)-4-methylidenepyrrolidin-2-yl]-1,3-oxazolidine?
2-[(2S)-4-methylidenepyrrolidin-2-yl]-1,3-oxazolidine has a molecular weight of 154.21 g/mol, XLogP of -0.15, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2S)-4-methylidenepyrrolidin-2-yl]-1,3-oxazolidine is sourced from PubChem (CID 122551448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).