C22H18F2N4O2 — CID 122551613
3-[2-(difluoromethoxy)phenyl]-11-(6-methoxy-3-pyridinyl)-2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraene (PubChem CID 122551613) has the molecular formula C22H18F2N4O2 and a molecular weight of 408.41 g/mol. Its IUPAC name is 3-[2-(difluoromethoxy)phenyl]-11-(6-methoxy-3-pyridinyl)-2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraene.
| Compound Name | 3-[2-(difluoromethoxy)phenyl]-11-(6-methoxy-3-pyridinyl)-2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraene |
|---|---|
| PubChem CID | 122551613 |
| Molecular Formula | C22H18F2N4O2 |
| Molecular Weight | 408.41 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | 3-[2-(difluoromethoxy)phenyl]-11-(6-methoxy-3-pyridinyl)-2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraene |
| SMILES | COc1ccc(-c2ccc3nc4n(c3n2)C(c2ccccc2OC(F)F)CC4)cn1 |
| InChI | InChI=1S/C22H18F2N4O2/c1-29-20-11-6-13(12-25-20)15-7-8-16-21(27-15)28-17(9-10-19(28)26-16)14-4-2-3-5-18(14)30-22(23)24/h2-8,11-12,17,22H,9-10H2,1H3 |
| InChIKey | YWGVUJDGXZCYRX-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 62.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.41 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |