C24H22F2N6O2 — CID 122551658
4-[5-[3-[2-(difluoromethoxy)phenyl]-2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraen-11-yl]pyrimidin-2-yl]morpholine (PubChem CID 122551658) has the molecular formula C24H22F2N6O2 and a molecular weight of 464.48 g/mol. Its IUPAC name is 4-[5-[3-[2-(difluoromethoxy)phenyl]-2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraen-11-yl]pyrimidin-2-yl]morpholine.
| Compound Name | 4-[5-[3-[2-(difluoromethoxy)phenyl]-2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraen-11-yl]pyrimidin-2-yl]morpholine |
|---|---|
| PubChem CID | 122551658 |
| Molecular Formula | C24H22F2N6O2 |
| Molecular Weight | 464.48 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | 4-[5-[3-[2-(difluoromethoxy)phenyl]-2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraen-11-yl]pyrimidin-2-yl]morpholine |
| SMILES | FC(F)Oc1ccccc1C1CCc2nc3ccc(-c4cnc(N5CCOCC5)nc4)nc3n21 |
| InChI | InChI=1S/C24H22F2N6O2/c25-23(26)34-20-4-2-1-3-16(20)19-7-8-21-29-18-6-5-17(30-22(18)32(19)21)15-13-27-24(28-14-15)31-9-11-33-12-10-31/h1-6,13-14,19,23H,7-12H2 |
| InChIKey | GALYFDYKAMGDGH-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 78.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.48 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |