C21H21N5 — CID 122551670
3-(2,5-dimethylphenyl)-11-(1-methylpyrazol-4-yl)-2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraene (PubChem CID 122551670) has the molecular formula C21H21N5 and a molecular weight of 343.43 g/mol. Its IUPAC name is 3-(2,5-dimethylphenyl)-11-(1-methylpyrazol-4-yl)-2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraene.
| Compound Name | 3-(2,5-dimethylphenyl)-11-(1-methylpyrazol-4-yl)-2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraene |
|---|---|
| PubChem CID | 122551670 |
| Molecular Formula | C21H21N5 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | 3-(2,5-dimethylphenyl)-11-(1-methylpyrazol-4-yl)-2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraene |
| SMILES | Cc1ccc(C)c(C2CCc3nc4ccc(-c5cnn(C)c5)nc4n32)c1 |
| InChI | InChI=1S/C21H21N5/c1-13-4-5-14(2)16(10-13)19-8-9-20-23-18-7-6-17(24-21(18)26(19)20)15-11-22-25(3)12-15/h4-7,10-12,19H,8-9H2,1-3H3 |
| InChIKey | PSRKUYMWFFZUMV-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |