C20H22CuO4 — CID 122552448
Copper bis(7-oxo-5-propylcyclohepta-1,3,5-trien-1-olate) (PubChem CID 122552448) has the molecular formula C20H22CuO4 and a molecular weight of 389.90 g/mol. Its IUPAC name is copper bis(7-oxo-5-propylcyclohepta-1,3,5-trien-1-olate).
| Compound Name | Copper bis(7-oxo-5-propylcyclohepta-1,3,5-trien-1-olate) |
|---|---|
| PubChem CID | 122552448 |
| Molecular Formula | C20H22CuO4 |
| Molecular Weight | 389.90 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | copper bis(7-oxo-5-propylcyclohepta-1,3,5-trien-1-olate) |
| SMILES | CCCC1=CC(=O)C(=CC=C1)[O-].CCCC1=CC(=O)C(=CC=C1)[O-].[Cu+2] |
| InChI | InChI=1S/2C10H12O2.Cu/c2*1-2-4-8-5-3-6-9(11)10(12)7-8;/h2*3,5-7H,2,4H2,1H3,(H,11,12);/q;;+2/p-2 |
| InChIKey | ORTHOBZKVUCENB-UHFFFAOYSA-L |
| XLogP | — |
| TPSA | 80.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | 270 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |