About 3-(2,5-ditert-butyl-4-hydroxyphenoxy)propane-1-sulfonic acid
3-(2,5-ditert-butyl-4-hydroxyphenoxy)propane-1-sulfonic acid (PubChem CID 122552483) has the molecular formula C17H28O5S
and a molecular weight of 344.47 g/mol. Its IUPAC name is 3-(2,5-ditert-butyl-4-hydroxyphenoxy)propane-1-sulfonic acid.
Molecular Properties
| Compound Name | 3-(2,5-ditert-butyl-4-hydroxyphenoxy)propane-1-sulfonic acid |
| PubChem CID | 122552483 |
| Molecular Formula | C17H28O5S |
| Molecular Weight | 344.47 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | 3-(2,5-ditert-butyl-4-hydroxyphenoxy)propane-1-sulfonic acid |
| SMILES | CC(C)(C)c1cc(OCCCS(=O)(=O)O)c(C(C)(C)C)cc1O |
| InChI | InChI=1S/C17H28O5S/c1-16(2,3)12-11-15(22-8-7-9-23(19,20)21)13(10-14(12)18)17(4,5)6/h10-11,18H,7-9H2,1-6H3,(H,19,20,21) |
| InChIKey | AYEOBBDGCQVDEE-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.47 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,5-ditert-butyl-4-hydroxyphenoxy)propane-1-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,5-ditert-butyl-4-hydroxyphenoxy)propane-1-sulfonic acid?
The IUPAC name of 3-(2,5-ditert-butyl-4-hydroxyphenoxy)propane-1-sulfonic acid (CID 122552483) is 3-(2,5-ditert-butyl-4-hydroxyphenoxy)propane-1-sulfonic acid.
What is the SMILES notation for 3-(2,5-ditert-butyl-4-hydroxyphenoxy)propane-1-sulfonic acid?
The canonical SMILES for 3-(2,5-ditert-butyl-4-hydroxyphenoxy)propane-1-sulfonic acid is CC(C)(C)c1cc(OCCCS(=O)(=O)O)c(C(C)(C)C)cc1O.
What is the InChIKey of 3-(2,5-ditert-butyl-4-hydroxyphenoxy)propane-1-sulfonic acid?
The InChIKey is AYEOBBDGCQVDEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28O5S/c1-16(2,3)12-11-15(22-8-7-9-23(19,20)21)13(10-14(12)18)17(4,5)6/h10-11,18H,7-9H2,1-6H3,(H,19,20,21).
What are the key properties of 3-(2,5-ditert-butyl-4-hydroxyphenoxy)propane-1-sulfonic acid?
3-(2,5-ditert-butyl-4-hydroxyphenoxy)propane-1-sulfonic acid has a molecular weight of 344.47 g/mol, XLogP of 3.64, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,5-ditert-butyl-4-hydroxyphenoxy)propane-1-sulfonic acid is sourced from PubChem (CID 122552483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).