About 3-[2-[1-(1-benzofuran-5-yl)imidazol-4-yl]cyclopropyl]propan-1-amine;carbonic acid
3-[2-[1-(1-benzofuran-5-yl)imidazol-4-yl]cyclopropyl]propan-1-amine;carbonic acid (PubChem CID 122552990) has the molecular formula C18H21N3O4
and a molecular weight of 343.38 g/mol. Its IUPAC name is 3-[2-[1-(1-benzofuran-5-yl)imidazol-4-yl]cyclopropyl]propan-1-amine;carbonic acid.
Molecular Properties
| Compound Name | 3-[2-[1-(1-benzofuran-5-yl)imidazol-4-yl]cyclopropyl]propan-1-amine;carbonic acid |
| PubChem CID | 122552990 |
| Molecular Formula | C18H21N3O4 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | 3-[2-[1-(1-benzofuran-5-yl)imidazol-4-yl]cyclopropyl]propan-1-amine;carbonic acid |
| SMILES | NCCCC1CC1c1cn(-c2ccc3occc3c2)cn1.O=C(O)O |
| InChI | InChI=1S/C17H19N3O.CH2O3/c18-6-1-2-12-9-15(12)16-10-20(11-19-16)14-3-4-17-13(8-14)5-7-21-17;2-1(3)4/h3-5,7-8,10-12,15H,1-2,6,9,18H2;(H2,2,3,4) |
| InChIKey | JIBFGDASMLGYTB-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 114.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[2-[1-(1-benzofuran-5-yl)imidazol-4-yl]cyclopropyl]propan-1-amine;carbonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-[1-(1-benzofuran-5-yl)imidazol-4-yl]cyclopropyl]propan-1-amine;carbonic acid?
The IUPAC name of 3-[2-[1-(1-benzofuran-5-yl)imidazol-4-yl]cyclopropyl]propan-1-amine;carbonic acid (CID 122552990) is 3-[2-[1-(1-benzofuran-5-yl)imidazol-4-yl]cyclopropyl]propan-1-amine;carbonic acid.
What is the SMILES notation for 3-[2-[1-(1-benzofuran-5-yl)imidazol-4-yl]cyclopropyl]propan-1-amine;carbonic acid?
The canonical SMILES for 3-[2-[1-(1-benzofuran-5-yl)imidazol-4-yl]cyclopropyl]propan-1-amine;carbonic acid is NCCCC1CC1c1cn(-c2ccc3occc3c2)cn1.O=C(O)O.
What is the InChIKey of 3-[2-[1-(1-benzofuran-5-yl)imidazol-4-yl]cyclopropyl]propan-1-amine;carbonic acid?
The InChIKey is JIBFGDASMLGYTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19N3O.CH2O3/c18-6-1-2-12-9-15(12)16-10-20(11-19-16)14-3-4-17-13(8-14)5-7-21-17;2-1(3)4/h3-5,7-8,10-12,15H,1-2,6,9,18H2;(H2,2,3,4).
What are the key properties of 3-[2-[1-(1-benzofuran-5-yl)imidazol-4-yl]cyclopropyl]propan-1-amine;carbonic acid?
3-[2-[1-(1-benzofuran-5-yl)imidazol-4-yl]cyclopropyl]propan-1-amine;carbonic acid has a molecular weight of 343.38 g/mol, XLogP of 3.68, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-[1-(1-benzofuran-5-yl)imidazol-4-yl]cyclopropyl]propan-1-amine;carbonic acid is sourced from PubChem (CID 122552990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).