About 5-bromo-1,3-dimethyl-1-oxido-2H-pyridin-1-ium
5-bromo-1,3-dimethyl-1-oxido-2H-pyridin-1-ium (PubChem CID 122553645) has the molecular formula C7H10BrNO
and a molecular weight of 204.07 g/mol. Its IUPAC name is 5-bromo-1,3-dimethyl-1-oxido-2H-pyridin-1-ium.
Molecular Properties
| Compound Name | 5-bromo-1,3-dimethyl-1-oxido-2H-pyridin-1-ium |
| PubChem CID | 122553645 |
| Molecular Formula | C7H10BrNO |
| Molecular Weight | 204.07 g/mol |
| Exact Mass | 202.99 |
| IUPAC Name | 5-bromo-1,3-dimethyl-1-oxido-2H-pyridin-1-ium |
| SMILES | CC1=CC(Br)=C[N+](C)([O-])C1 |
| InChI | InChI=1S/C7H10BrNO/c1-6-3-7(8)5-9(2,10)4-6/h3,5H,4H2,1-2H3 |
| InChIKey | RRISXEUMTJYTLU-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.07 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-1,3-dimethyl-1-oxido-2H-pyridin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-1,3-dimethyl-1-oxido-2H-pyridin-1-ium?
The IUPAC name of 5-bromo-1,3-dimethyl-1-oxido-2H-pyridin-1-ium (CID 122553645) is 5-bromo-1,3-dimethyl-1-oxido-2H-pyridin-1-ium.
What is the SMILES notation for 5-bromo-1,3-dimethyl-1-oxido-2H-pyridin-1-ium?
The canonical SMILES for 5-bromo-1,3-dimethyl-1-oxido-2H-pyridin-1-ium is CC1=CC(Br)=C[N+](C)([O-])C1.
What is the InChIKey of 5-bromo-1,3-dimethyl-1-oxido-2H-pyridin-1-ium?
The InChIKey is RRISXEUMTJYTLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10BrNO/c1-6-3-7(8)5-9(2,10)4-6/h3,5H,4H2,1-2H3.
What are the key properties of 5-bromo-1,3-dimethyl-1-oxido-2H-pyridin-1-ium?
5-bromo-1,3-dimethyl-1-oxido-2H-pyridin-1-ium has a molecular weight of 204.07 g/mol, XLogP of 2.13, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-1,3-dimethyl-1-oxido-2H-pyridin-1-ium is sourced from PubChem (CID 122553645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).