C11H8F3N3O2 — CID 122554513
methyl 6-[5-(trifluoromethyl)-1H-imidazol-2-yl]pyridine-3-carboxylate (PubChem CID 122554513) has the molecular formula C11H8F3N3O2 and a molecular weight of 271.20 g/mol. Its IUPAC name is methyl 6-[5-(trifluoromethyl)-1H-imidazol-2-yl]pyridine-3-carboxylate.
| Compound Name | methyl 6-[5-(trifluoromethyl)-1H-imidazol-2-yl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 122554513 |
| Molecular Formula | C11H8F3N3O2 |
| Molecular Weight | 271.20 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | methyl 6-[5-(trifluoromethyl)-1H-imidazol-2-yl]pyridine-3-carboxylate |
| SMILES | COC(=O)c1ccc(-c2ncc(C(F)(F)F)[nH]2)nc1 |
| InChI | InChI=1S/C11H8F3N3O2/c1-19-10(18)6-2-3-7(15-4-6)9-16-5-8(17-9)11(12,13)14/h2-5H,1H3,(H,16,17) |
| InChIKey | UZSULKAGXPBGSC-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.20 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |