C11H6F6O2 — CID 122554566
3,3,4,4,5,5-hexafluoro-1,2-bis(prop-2-ynoxy)cyclopentene (PubChem CID 122554566) has the molecular formula C11H6F6O2 and a molecular weight of 284.15 g/mol. Its IUPAC name is 3,3,4,4,5,5-hexafluoro-1,2-bis(prop-2-ynoxy)cyclopentene.
| Compound Name | 3,3,4,4,5,5-hexafluoro-1,2-bis(prop-2-ynoxy)cyclopentene |
|---|---|
| PubChem CID | 122554566 |
| Molecular Formula | C11H6F6O2 |
| Molecular Weight | 284.15 g/mol |
| Exact Mass | 284.03 |
| IUPAC Name | 3,3,4,4,5,5-hexafluoro-1,2-bis(prop-2-ynoxy)cyclopentene |
| SMILES | C#CCOC1=C(OCC#C)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C11H6F6O2/c1-3-5-18-7-8(19-6-4-2)10(14,15)11(16,17)9(7,12)13/h1-2H,5-6H2 |
| InChIKey | FKVWRWHMJOIQEN-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.15 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|