C15H18F6O2 — CID 122554585
3,3,4,4,5,5-hexafluoro-1,2-bis(pent-4-enoxy)cyclopentene (PubChem CID 122554585) has the molecular formula C15H18F6O2 and a molecular weight of 344.30 g/mol. Its IUPAC name is 3,3,4,4,5,5-hexafluoro-1,2-bis(pent-4-enoxy)cyclopentene.
| Compound Name | 3,3,4,4,5,5-hexafluoro-1,2-bis(pent-4-enoxy)cyclopentene |
|---|---|
| PubChem CID | 122554585 |
| Molecular Formula | C15H18F6O2 |
| Molecular Weight | 344.30 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | 3,3,4,4,5,5-hexafluoro-1,2-bis(pent-4-enoxy)cyclopentene |
| SMILES | C=CCCCOC1=C(OCCCC=C)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C15H18F6O2/c1-3-5-7-9-22-11-12(23-10-8-6-4-2)14(18,19)15(20,21)13(11,16)17/h3-4H,1-2,5-10H2 |
| InChIKey | OSFJJZYPAHDKEF-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.30 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|