C8H3F7O — CID 122554596
1,3,3,4,4,5,5-heptafluoro-2-prop-2-ynoxycyclopentene (PubChem CID 122554596) has the molecular formula C8H3F7O and a molecular weight of 248.10 g/mol. Its IUPAC name is 1,3,3,4,4,5,5-heptafluoro-2-prop-2-ynoxycyclopentene.
| Compound Name | 1,3,3,4,4,5,5-heptafluoro-2-prop-2-ynoxycyclopentene |
|---|---|
| PubChem CID | 122554596 |
| Molecular Formula | C8H3F7O |
| Molecular Weight | 248.10 g/mol |
| Exact Mass | 248.01 |
| IUPAC Name | 1,3,3,4,4,5,5-heptafluoro-2-prop-2-ynoxycyclopentene |
| SMILES | C#CCOC1=C(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C8H3F7O/c1-2-3-16-5-4(9)6(10,11)8(14,15)7(5,12)13/h1H,3H2 |
| InChIKey | DGBVZVNBCLPWFR-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.10 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|