C32H35N9O2 — CID 122554984
4-(aminomethyl)-N-[(2S)-2-amino-3-[4-(3-methylbenzimidazol-5-yl)phenyl]propanoyl]-N-[4-(2H-tetrazol-5-yl)phenyl]cyclohexane-1-carboxamide (PubChem CID 122554984) has the molecular formula C32H35N9O2 and a molecular weight of 577.69 g/mol. Its IUPAC name is 4-(aminomethyl)-N-[(2S)-2-amino-3-[4-(3-methylbenzimidazol-5-yl)phenyl]propanoyl]-N-[4-(2H-tetrazol-5-yl)phenyl]cyclohexane-1-carboxamide.
| Compound Name | 4-(aminomethyl)-N-[(2S)-2-amino-3-[4-(3-methylbenzimidazol-5-yl)phenyl]propanoyl]-N-[4-(2H-tetrazol-5-yl)phenyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 122554984 |
| Molecular Formula | C32H35N9O2 |
| Molecular Weight | 577.69 g/mol |
| Exact Mass | 577.29 |
| IUPAC Name | 4-(aminomethyl)-N-[(2S)-2-amino-3-[4-(3-methylbenzimidazol-5-yl)phenyl]propanoyl]-N-[4-(2H-tetrazol-5-yl)phenyl]cyclohexane-1-carboxamide |
| SMILES | Cn1cnc2ccc(-c3ccc(C[C@H](N)C(=O)N(C(=O)C4CCC(CN)CC4)c4ccc(-c5nn[nH]n5)cc4)cc3)cc21 |
| InChI | InChI=1S/C32H35N9O2/c1-40-19-35-28-15-12-25(17-29(28)40)22-6-2-20(3-7-22)16-27(34)32(43)41(31(42)24-8-4-21(18-33)5-9-24)26-13-10-23(11-14-26)30-36-38-39-37-30/h2-3,6-7,10-15,17,19,21,24,27H,4-5,8-9,16,18,33-34H2,1H3,(H,36,37,38,39)/t21?,24?,27-/m0/s1 |
| InChIKey | QCHZSCMIZNVLFQ-CGYPVTCASA-N |
| XLogP | 3.62 |
| TPSA | 161.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.69 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |