C31H40ClN3O3 — CID 122555710
N-[(1R,2R)-1-(3-chloro-4-cyclopropyloxyphenyl)-1-hydroxy-3-pyrrolidin-1-ylpropan-2-yl]-1-(5,6,7,8-tetrahydronaphthalen-2-yl)pyrrolidine-3-carboxamide (PubChem CID 122555710) has the molecular formula C31H40ClN3O3 and a molecular weight of 538.13 g/mol. Its IUPAC name is N-[(1R,2R)-1-(3-chloro-4-cyclopropyloxyphenyl)-1-hydroxy-3-pyrrolidin-1-ylpropan-2-yl]-1-(5,6,7,8-tetrahydronaphthalen-2-yl)pyrrolidine-3-carboxamide.
| Compound Name | N-[(1R,2R)-1-(3-chloro-4-cyclopropyloxyphenyl)-1-hydroxy-3-pyrrolidin-1-ylpropan-2-yl]-1-(5,6,7,8-tetrahydronaphthalen-2-yl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 122555710 |
| Molecular Formula | C31H40ClN3O3 |
| Molecular Weight | 538.13 g/mol |
| Exact Mass | 537.28 |
| IUPAC Name | N-[(1R,2R)-1-(3-chloro-4-cyclopropyloxyphenyl)-1-hydroxy-3-pyrrolidin-1-ylpropan-2-yl]-1-(5,6,7,8-tetrahydronaphthalen-2-yl)pyrrolidine-3-carboxamide |
| SMILES | O=C(N[C@H](CN1CCCC1)[C@H](O)c1ccc(OC2CC2)c(Cl)c1)C1CCN(c2ccc3c(c2)CCCC3)C1 |
| InChI | InChI=1S/C31H40ClN3O3/c32-27-18-23(8-12-29(27)38-26-10-11-26)30(36)28(20-34-14-3-4-15-34)33-31(37)24-13-16-35(19-24)25-9-7-21-5-1-2-6-22(21)17-25/h7-9,12,17-18,24,26,28,30,36H,1-6,10-11,13-16,19-20H2,(H,33,37)/t24?,28-,30-/m1/s1 |
| InChIKey | ZEWLEWSOUCEBPT-GHSZDGRPSA-N |
| XLogP | 4.90 |
| TPSA | 65.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.13 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|