About 7-fluoro-N-[(3S,4S)-4-methoxy-1-methylpyrrolidin-3-yl]-1-benzofuran-2-carboxamide
7-fluoro-N-[(3S,4S)-4-methoxy-1-methylpyrrolidin-3-yl]-1-benzofuran-2-carboxamide (PubChem CID 122555918) has the molecular formula C15H17FN2O3
and a molecular weight of 292.31 g/mol. Its IUPAC name is 7-fluoro-N-[(3S,4S)-4-methoxy-1-methylpyrrolidin-3-yl]-1-benzofuran-2-carboxamide.
Molecular Properties
| Compound Name | 7-fluoro-N-[(3S,4S)-4-methoxy-1-methylpyrrolidin-3-yl]-1-benzofuran-2-carboxamide |
| PubChem CID | 122555918 |
| Molecular Formula | C15H17FN2O3 |
| Molecular Weight | 292.31 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 7-fluoro-N-[(3S,4S)-4-methoxy-1-methylpyrrolidin-3-yl]-1-benzofuran-2-carboxamide |
| SMILES | CO[C@H]1CN(C)C[C@@H]1NC(=O)c1cc2cccc(F)c2o1 |
| InChI | InChI=1S/C15H17FN2O3/c1-18-7-11(13(8-18)20-2)17-15(19)12-6-9-4-3-5-10(16)14(9)21-12/h3-6,11,13H,7-8H2,1-2H3,(H,17,19)/t11-,13-/m0/s1 |
| InChIKey | HRDINCDQOWQHFX-AAEUAGOBSA-N |
| XLogP | 1.63 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.31 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-fluoro-N-[(3S,4S)-4-methoxy-1-methylpyrrolidin-3-yl]-1-benzofuran-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-N-[(3S,4S)-4-methoxy-1-methylpyrrolidin-3-yl]-1-benzofuran-2-carboxamide?
The IUPAC name of 7-fluoro-N-[(3S,4S)-4-methoxy-1-methylpyrrolidin-3-yl]-1-benzofuran-2-carboxamide (CID 122555918) is 7-fluoro-N-[(3S,4S)-4-methoxy-1-methylpyrrolidin-3-yl]-1-benzofuran-2-carboxamide.
What is the SMILES notation for 7-fluoro-N-[(3S,4S)-4-methoxy-1-methylpyrrolidin-3-yl]-1-benzofuran-2-carboxamide?
The canonical SMILES for 7-fluoro-N-[(3S,4S)-4-methoxy-1-methylpyrrolidin-3-yl]-1-benzofuran-2-carboxamide is CO[C@H]1CN(C)C[C@@H]1NC(=O)c1cc2cccc(F)c2o1.
What is the InChIKey of 7-fluoro-N-[(3S,4S)-4-methoxy-1-methylpyrrolidin-3-yl]-1-benzofuran-2-carboxamide?
The InChIKey is HRDINCDQOWQHFX-AAEUAGOBSA-N. The full InChI is InChI=1S/C15H17FN2O3/c1-18-7-11(13(8-18)20-2)17-15(19)12-6-9-4-3-5-10(16)14(9)21-12/h3-6,11,13H,7-8H2,1-2H3,(H,17,19)/t11-,13-/m0/s1.
What are the key properties of 7-fluoro-N-[(3S,4S)-4-methoxy-1-methylpyrrolidin-3-yl]-1-benzofuran-2-carboxamide?
7-fluoro-N-[(3S,4S)-4-methoxy-1-methylpyrrolidin-3-yl]-1-benzofuran-2-carboxamide has a molecular weight of 292.31 g/mol, XLogP of 1.63, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-N-[(3S,4S)-4-methoxy-1-methylpyrrolidin-3-yl]-1-benzofuran-2-carboxamide is sourced from PubChem (CID 122555918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).