C15H28N2O2 — CID 122555981
N-[2-[4-(hydroxymethyl)piperidin-1-yl]ethyl]-3-(1-methylcyclopropyl)propanamide (PubChem CID 122555981) has the molecular formula C15H28N2O2 and a molecular weight of 268.40 g/mol. Its IUPAC name is N-[2-[4-(hydroxymethyl)piperidin-1-yl]ethyl]-3-(1-methylcyclopropyl)propanamide.
| Compound Name | N-[2-[4-(hydroxymethyl)piperidin-1-yl]ethyl]-3-(1-methylcyclopropyl)propanamide |
|---|---|
| PubChem CID | 122555981 |
| Molecular Formula | C15H28N2O2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.22 |
| IUPAC Name | N-[2-[4-(hydroxymethyl)piperidin-1-yl]ethyl]-3-(1-methylcyclopropyl)propanamide |
| SMILES | CC1(CCC(=O)NCCN2CCC(CO)CC2)CC1 |
| InChI | InChI=1S/C15H28N2O2/c1-15(6-7-15)5-2-14(19)16-8-11-17-9-3-13(12-18)4-10-17/h13,18H,2-12H2,1H3,(H,16,19) |
| InChIKey | HUPRZUMAFUTBHA-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |