C21H30N4O — CID 122556951
4-(3-phenylpropyl)-N-(2-pyrrol-1-ylethyl)-1,4-diazepane-1-carboxamide (PubChem CID 122556951) has the molecular formula C21H30N4O and a molecular weight of 354.50 g/mol. Its IUPAC name is 4-(3-phenylpropyl)-N-(2-pyrrol-1-ylethyl)-1,4-diazepane-1-carboxamide.
| Compound Name | 4-(3-phenylpropyl)-N-(2-pyrrol-1-ylethyl)-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 122556951 |
| Molecular Formula | C21H30N4O |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | 4-(3-phenylpropyl)-N-(2-pyrrol-1-ylethyl)-1,4-diazepane-1-carboxamide |
| SMILES | O=C(NCCn1cccc1)N1CCCN(CCCc2ccccc2)CC1 |
| InChI | InChI=1S/C21H30N4O/c26-21(22-11-17-23-12-4-5-13-23)25-16-7-15-24(18-19-25)14-6-10-20-8-2-1-3-9-20/h1-5,8-9,12-13H,6-7,10-11,14-19H2,(H,22,26) |
| InChIKey | NYNBCCMXOWZYQB-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 40.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |