C21H32N2O3 — CID 122557157
N-[2-(1-hydroxycyclopentyl)ethyl]-4-(1-hydroxy-2-phenylethyl)piperidine-1-carboxamide (PubChem CID 122557157) has the molecular formula C21H32N2O3 and a molecular weight of 360.50 g/mol. Its IUPAC name is N-[2-(1-hydroxycyclopentyl)ethyl]-4-(1-hydroxy-2-phenylethyl)piperidine-1-carboxamide.
| Compound Name | N-[2-(1-hydroxycyclopentyl)ethyl]-4-(1-hydroxy-2-phenylethyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 122557157 |
| Molecular Formula | C21H32N2O3 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.24 |
| IUPAC Name | N-[2-(1-hydroxycyclopentyl)ethyl]-4-(1-hydroxy-2-phenylethyl)piperidine-1-carboxamide |
| SMILES | O=C(NCCC1(O)CCCC1)N1CCC(C(O)Cc2ccccc2)CC1 |
| InChI | InChI=1S/C21H32N2O3/c24-19(16-17-6-2-1-3-7-17)18-8-14-23(15-9-18)20(25)22-13-12-21(26)10-4-5-11-21/h1-3,6-7,18-19,24,26H,4-5,8-16H2,(H,22,25) |
| InChIKey | VQERPEKWQWLHMD-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |