About 4,5-dichloro-N-[(3S,4S)-4-methoxy-1-methylpyrrolidin-3-yl]thiophene-2-sulfonamide
4,5-dichloro-N-[(3S,4S)-4-methoxy-1-methylpyrrolidin-3-yl]thiophene-2-sulfonamide (PubChem CID 122557495) has the molecular formula C10H14Cl2N2O3S2
and a molecular weight of 345.27 g/mol. Its IUPAC name is 4,5-dichloro-N-[(3S,4S)-4-methoxy-1-methylpyrrolidin-3-yl]thiophene-2-sulfonamide.
Molecular Properties
| Compound Name | 4,5-dichloro-N-[(3S,4S)-4-methoxy-1-methylpyrrolidin-3-yl]thiophene-2-sulfonamide |
| PubChem CID | 122557495 |
| Molecular Formula | C10H14Cl2N2O3S2 |
| Molecular Weight | 345.27 g/mol |
| Exact Mass | 343.98 |
| IUPAC Name | 4,5-dichloro-N-[(3S,4S)-4-methoxy-1-methylpyrrolidin-3-yl]thiophene-2-sulfonamide |
| SMILES | CO[C@H]1CN(C)C[C@@H]1NS(=O)(=O)c1cc(Cl)c(Cl)s1 |
| InChI | InChI=1S/C10H14Cl2N2O3S2/c1-14-4-7(8(5-14)17-2)13-19(15,16)9-3-6(11)10(12)18-9/h3,7-8,13H,4-5H2,1-2H3/t7-,8-/m0/s1 |
| InChIKey | YQFNVULYDNXIME-YUMQZZPRSA-N |
| XLogP | 1.66 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.27 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4,5-dichloro-N-[(3S,4S)-4-methoxy-1-methylpyrrolidin-3-yl]thiophene-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dichloro-N-[(3S,4S)-4-methoxy-1-methylpyrrolidin-3-yl]thiophene-2-sulfonamide?
The IUPAC name of 4,5-dichloro-N-[(3S,4S)-4-methoxy-1-methylpyrrolidin-3-yl]thiophene-2-sulfonamide (CID 122557495) is 4,5-dichloro-N-[(3S,4S)-4-methoxy-1-methylpyrrolidin-3-yl]thiophene-2-sulfonamide.
What is the SMILES notation for 4,5-dichloro-N-[(3S,4S)-4-methoxy-1-methylpyrrolidin-3-yl]thiophene-2-sulfonamide?
The canonical SMILES for 4,5-dichloro-N-[(3S,4S)-4-methoxy-1-methylpyrrolidin-3-yl]thiophene-2-sulfonamide is CO[C@H]1CN(C)C[C@@H]1NS(=O)(=O)c1cc(Cl)c(Cl)s1.
What is the InChIKey of 4,5-dichloro-N-[(3S,4S)-4-methoxy-1-methylpyrrolidin-3-yl]thiophene-2-sulfonamide?
The InChIKey is YQFNVULYDNXIME-YUMQZZPRSA-N. The full InChI is InChI=1S/C10H14Cl2N2O3S2/c1-14-4-7(8(5-14)17-2)13-19(15,16)9-3-6(11)10(12)18-9/h3,7-8,13H,4-5H2,1-2H3/t7-,8-/m0/s1.
What are the key properties of 4,5-dichloro-N-[(3S,4S)-4-methoxy-1-methylpyrrolidin-3-yl]thiophene-2-sulfonamide?
4,5-dichloro-N-[(3S,4S)-4-methoxy-1-methylpyrrolidin-3-yl]thiophene-2-sulfonamide has a molecular weight of 345.27 g/mol, XLogP of 1.66, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dichloro-N-[(3S,4S)-4-methoxy-1-methylpyrrolidin-3-yl]thiophene-2-sulfonamide is sourced from PubChem (CID 122557495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).