About N-[(3,5-dimethyl-4-oxo-1H-pyridin-2-yl)methyl]-2-phenylmethoxyacetamide
N-[(3,5-dimethyl-4-oxo-1H-pyridin-2-yl)methyl]-2-phenylmethoxyacetamide (PubChem CID 122558806) has the molecular formula C17H20N2O3
and a molecular weight of 300.36 g/mol. Its IUPAC name is N-[(3,5-dimethyl-4-oxo-1H-pyridin-2-yl)methyl]-2-phenylmethoxyacetamide.
Molecular Properties
| Compound Name | N-[(3,5-dimethyl-4-oxo-1H-pyridin-2-yl)methyl]-2-phenylmethoxyacetamide |
| PubChem CID | 122558806 |
| Molecular Formula | C17H20N2O3 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | N-[(3,5-dimethyl-4-oxo-1H-pyridin-2-yl)methyl]-2-phenylmethoxyacetamide |
| SMILES | Cc1c[nH]c(CNC(=O)COCc2ccccc2)c(C)c1=O |
| InChI | InChI=1S/C17H20N2O3/c1-12-8-18-15(13(2)17(12)21)9-19-16(20)11-22-10-14-6-4-3-5-7-14/h3-8H,9-11H2,1-2H3,(H,18,21)(H,19,20) |
| InChIKey | MMZGNKCDNOEWOM-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(3,5-dimethyl-4-oxo-1H-pyridin-2-yl)methyl]-2-phenylmethoxyacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3,5-dimethyl-4-oxo-1H-pyridin-2-yl)methyl]-2-phenylmethoxyacetamide?
The IUPAC name of N-[(3,5-dimethyl-4-oxo-1H-pyridin-2-yl)methyl]-2-phenylmethoxyacetamide (CID 122558806) is N-[(3,5-dimethyl-4-oxo-1H-pyridin-2-yl)methyl]-2-phenylmethoxyacetamide.
What is the SMILES notation for N-[(3,5-dimethyl-4-oxo-1H-pyridin-2-yl)methyl]-2-phenylmethoxyacetamide?
The canonical SMILES for N-[(3,5-dimethyl-4-oxo-1H-pyridin-2-yl)methyl]-2-phenylmethoxyacetamide is Cc1c[nH]c(CNC(=O)COCc2ccccc2)c(C)c1=O.
What is the InChIKey of N-[(3,5-dimethyl-4-oxo-1H-pyridin-2-yl)methyl]-2-phenylmethoxyacetamide?
The InChIKey is MMZGNKCDNOEWOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N2O3/c1-12-8-18-15(13(2)17(12)21)9-19-16(20)11-22-10-14-6-4-3-5-7-14/h3-8H,9-11H2,1-2H3,(H,18,21)(H,19,20).
What are the key properties of N-[(3,5-dimethyl-4-oxo-1H-pyridin-2-yl)methyl]-2-phenylmethoxyacetamide?
N-[(3,5-dimethyl-4-oxo-1H-pyridin-2-yl)methyl]-2-phenylmethoxyacetamide has a molecular weight of 300.36 g/mol, XLogP of 1.82, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3,5-dimethyl-4-oxo-1H-pyridin-2-yl)methyl]-2-phenylmethoxyacetamide is sourced from PubChem (CID 122558806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).