C16H30N2O2 — CID 122559584
N-[(1-cyclohexylpyrrolidin-3-yl)methyl]-3-ethoxypropanamide (PubChem CID 122559584) has the molecular formula C16H30N2O2 and a molecular weight of 282.43 g/mol. Its IUPAC name is N-[(1-cyclohexylpyrrolidin-3-yl)methyl]-3-ethoxypropanamide.
| Compound Name | N-[(1-cyclohexylpyrrolidin-3-yl)methyl]-3-ethoxypropanamide |
|---|---|
| PubChem CID | 122559584 |
| Molecular Formula | C16H30N2O2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.23 |
| IUPAC Name | N-[(1-cyclohexylpyrrolidin-3-yl)methyl]-3-ethoxypropanamide |
| SMILES | CCOCCC(=O)NCC1CCN(C2CCCCC2)C1 |
| InChI | InChI=1S/C16H30N2O2/c1-2-20-11-9-16(19)17-12-14-8-10-18(13-14)15-6-4-3-5-7-15/h14-15H,2-13H2,1H3,(H,17,19) |
| InChIKey | WUGWCGZMCPPGCF-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|