C14H21N3O3S — CID 122559715
(4aS,7aS)-N-benzyl-N-methyl-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazine-6-sulfonamide (PubChem CID 122559715) has the molecular formula C14H21N3O3S and a molecular weight of 311.41 g/mol. Its IUPAC name is (4aS,7aS)-N-benzyl-N-methyl-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazine-6-sulfonamide.
| Compound Name | (4aS,7aS)-N-benzyl-N-methyl-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazine-6-sulfonamide |
|---|---|
| PubChem CID | 122559715 |
| Molecular Formula | C14H21N3O3S |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | (4aS,7aS)-N-benzyl-N-methyl-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazine-6-sulfonamide |
| SMILES | CN(Cc1ccccc1)S(=O)(=O)N1C[C@@H]2NCCO[C@H]2C1 |
| InChI | InChI=1S/C14H21N3O3S/c1-16(9-12-5-3-2-4-6-12)21(18,19)17-10-13-14(11-17)20-8-7-15-13/h2-6,13-15H,7-11H2,1H3/t13-,14-/m0/s1 |
| InChIKey | CJIDNTXUNVFABY-KBPBESRZSA-N |
| XLogP | 0.04 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |