About 7-chloro-N-[(3S,4R)-4-ethoxyoxolan-3-yl]quinolin-4-amine
7-chloro-N-[(3S,4R)-4-ethoxyoxolan-3-yl]quinolin-4-amine (PubChem CID 122561077) has the molecular formula C15H17ClN2O2
and a molecular weight of 292.77 g/mol. Its IUPAC name is 7-chloro-N-[(3S,4R)-4-ethoxyoxolan-3-yl]quinolin-4-amine.
Molecular Properties
| Compound Name | 7-chloro-N-[(3S,4R)-4-ethoxyoxolan-3-yl]quinolin-4-amine |
| PubChem CID | 122561077 |
| Molecular Formula | C15H17ClN2O2 |
| Molecular Weight | 292.77 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 7-chloro-N-[(3S,4R)-4-ethoxyoxolan-3-yl]quinolin-4-amine |
| SMILES | CCO[C@H]1COC[C@@H]1Nc1ccnc2cc(Cl)ccc12 |
| InChI | InChI=1S/C15H17ClN2O2/c1-2-20-15-9-19-8-14(15)18-12-5-6-17-13-7-10(16)3-4-11(12)13/h3-7,14-15H,2,8-9H2,1H3,(H,17,18)/t14-,15-/m0/s1 |
| InChIKey | DZHFBOBQNPRUOI-GJZGRUSLSA-N |
| XLogP | 3.10 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.77 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-chloro-N-[(3S,4R)-4-ethoxyoxolan-3-yl]quinolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-N-[(3S,4R)-4-ethoxyoxolan-3-yl]quinolin-4-amine?
The IUPAC name of 7-chloro-N-[(3S,4R)-4-ethoxyoxolan-3-yl]quinolin-4-amine (CID 122561077) is 7-chloro-N-[(3S,4R)-4-ethoxyoxolan-3-yl]quinolin-4-amine.
What is the SMILES notation for 7-chloro-N-[(3S,4R)-4-ethoxyoxolan-3-yl]quinolin-4-amine?
The canonical SMILES for 7-chloro-N-[(3S,4R)-4-ethoxyoxolan-3-yl]quinolin-4-amine is CCO[C@H]1COC[C@@H]1Nc1ccnc2cc(Cl)ccc12.
What is the InChIKey of 7-chloro-N-[(3S,4R)-4-ethoxyoxolan-3-yl]quinolin-4-amine?
The InChIKey is DZHFBOBQNPRUOI-GJZGRUSLSA-N. The full InChI is InChI=1S/C15H17ClN2O2/c1-2-20-15-9-19-8-14(15)18-12-5-6-17-13-7-10(16)3-4-11(12)13/h3-7,14-15H,2,8-9H2,1H3,(H,17,18)/t14-,15-/m0/s1.
What are the key properties of 7-chloro-N-[(3S,4R)-4-ethoxyoxolan-3-yl]quinolin-4-amine?
7-chloro-N-[(3S,4R)-4-ethoxyoxolan-3-yl]quinolin-4-amine has a molecular weight of 292.77 g/mol, XLogP of 3.10, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-N-[(3S,4R)-4-ethoxyoxolan-3-yl]quinolin-4-amine is sourced from PubChem (CID 122561077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).