C11H17N3OS — CID 122561669
(4aS,7aS)-6-(4,5-dimethyl-1,3-thiazol-2-yl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazine (PubChem CID 122561669) has the molecular formula C11H17N3OS and a molecular weight of 239.34 g/mol. Its IUPAC name is (4aS,7aS)-6-(4,5-dimethyl-1,3-thiazol-2-yl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazine.
| Compound Name | (4aS,7aS)-6-(4,5-dimethyl-1,3-thiazol-2-yl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazine |
|---|---|
| PubChem CID | 122561669 |
| Molecular Formula | C11H17N3OS |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | (4aS,7aS)-6-(4,5-dimethyl-1,3-thiazol-2-yl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazine |
| SMILES | Cc1nc(N2C[C@@H]3NCCO[C@H]3C2)sc1C |
| InChI | InChI=1S/C11H17N3OS/c1-7-8(2)16-11(13-7)14-5-9-10(6-14)15-4-3-12-9/h9-10,12H,3-6H2,1-2H3/t9-,10-/m0/s1 |
| InChIKey | TWEYGGRRKPROKW-UWVGGRQHSA-N |
| XLogP | 0.94 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |