C13H19NOS2 — CID 122562649
[3-[(1,4-dithiepan-6-ylamino)methyl]phenyl]methanol (PubChem CID 122562649) has the molecular formula C13H19NOS2 and a molecular weight of 269.44 g/mol. Its IUPAC name is [3-[(1,4-dithiepan-6-ylamino)methyl]phenyl]methanol.
| Compound Name | [3-[(1,4-dithiepan-6-ylamino)methyl]phenyl]methanol |
|---|---|
| PubChem CID | 122562649 |
| Molecular Formula | C13H19NOS2 |
| Molecular Weight | 269.44 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | [3-[(1,4-dithiepan-6-ylamino)methyl]phenyl]methanol |
| SMILES | OCc1cccc(CNC2CSCCSC2)c1 |
| InChI | InChI=1S/C13H19NOS2/c15-8-12-3-1-2-11(6-12)7-14-13-9-16-4-5-17-10-13/h1-3,6,13-15H,4-5,7-10H2 |
| InChIKey | MHDUNXNSSVKIML-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.44 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |