C18H26N2O4 — CID 122562793
N-[2-(1-hydroxycyclopentyl)ethyl]-3-(3-methoxyphenoxy)azetidine-1-carboxamide (PubChem CID 122562793) has the molecular formula C18H26N2O4 and a molecular weight of 334.42 g/mol. Its IUPAC name is N-[2-(1-hydroxycyclopentyl)ethyl]-3-(3-methoxyphenoxy)azetidine-1-carboxamide.
| Compound Name | N-[2-(1-hydroxycyclopentyl)ethyl]-3-(3-methoxyphenoxy)azetidine-1-carboxamide |
|---|---|
| PubChem CID | 122562793 |
| Molecular Formula | C18H26N2O4 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | N-[2-(1-hydroxycyclopentyl)ethyl]-3-(3-methoxyphenoxy)azetidine-1-carboxamide |
| SMILES | COc1cccc(OC2CN(C(=O)NCCC3(O)CCCC3)C2)c1 |
| InChI | InChI=1S/C18H26N2O4/c1-23-14-5-4-6-15(11-14)24-16-12-20(13-16)17(21)19-10-9-18(22)7-2-3-8-18/h4-6,11,16,22H,2-3,7-10,12-13H2,1H3,(H,19,21) |
| InChIKey | JVUAQNSYTKZWQY-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |