C18H26N2O4S — CID 122562878
N-[(3aR,6R,7aS)-3a-methoxy-1-(2-thiophen-3-ylacetyl)-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-2-methoxyacetamide (PubChem CID 122562878) has the molecular formula C18H26N2O4S and a molecular weight of 366.48 g/mol. Its IUPAC name is N-[(3aR,6R,7aS)-3a-methoxy-1-(2-thiophen-3-ylacetyl)-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-2-methoxyacetamide.
| Compound Name | N-[(3aR,6R,7aS)-3a-methoxy-1-(2-thiophen-3-ylacetyl)-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-2-methoxyacetamide |
|---|---|
| PubChem CID | 122562878 |
| Molecular Formula | C18H26N2O4S |
| Molecular Weight | 366.48 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | N-[(3aR,6R,7aS)-3a-methoxy-1-(2-thiophen-3-ylacetyl)-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-2-methoxyacetamide |
| SMILES | COCC(=O)N[C@@H]1CC[C@@]2(OC)CCN(C(=O)Cc3ccsc3)[C@H]2C1 |
| InChI | InChI=1S/C18H26N2O4S/c1-23-11-16(21)19-14-3-5-18(24-2)6-7-20(15(18)10-14)17(22)9-13-4-8-25-12-13/h4,8,12,14-15H,3,5-7,9-11H2,1-2H3,(H,19,21)/t14-,15+,18-/m1/s1 |
| InChIKey | YXPUOFJZWOFADJ-RVKKMQEKSA-N |
| XLogP | 1.59 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.48 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |