C13H9F2NO3 — CID 122563348
6-(3,4-difluorophenyl)-5-methoxypyridine-2-carboxylic acid (PubChem CID 122563348) has the molecular formula C13H9F2NO3 and a molecular weight of 265.22 g/mol. Its IUPAC name is 6-(3,4-difluorophenyl)-5-methoxypyridine-2-carboxylic acid.
| Compound Name | 6-(3,4-difluorophenyl)-5-methoxypyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 122563348 |
| Molecular Formula | C13H9F2NO3 |
| Molecular Weight | 265.22 g/mol |
| Exact Mass | 265.06 |
| IUPAC Name | 6-(3,4-difluorophenyl)-5-methoxypyridine-2-carboxylic acid |
| SMILES | COc1ccc(C(=O)O)nc1-c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C13H9F2NO3/c1-19-11-5-4-10(13(17)18)16-12(11)7-2-3-8(14)9(15)6-7/h2-6H,1H3,(H,17,18) |
| InChIKey | WRMNRBTYQXZBGV-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.22 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |