C17H24ClN3OS — CID 122563662
N-[2-(4-chlorophenyl)-2-pyrrolidin-1-ylethyl]thiomorpholine-4-carboxamide (PubChem CID 122563662) has the molecular formula C17H24ClN3OS and a molecular weight of 353.92 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)-2-pyrrolidin-1-ylethyl]thiomorpholine-4-carboxamide.
| Compound Name | N-[2-(4-chlorophenyl)-2-pyrrolidin-1-ylethyl]thiomorpholine-4-carboxamide |
|---|---|
| PubChem CID | 122563662 |
| Molecular Formula | C17H24ClN3OS |
| Molecular Weight | 353.92 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | N-[2-(4-chlorophenyl)-2-pyrrolidin-1-ylethyl]thiomorpholine-4-carboxamide |
| SMILES | O=C(NCC(c1ccc(Cl)cc1)N1CCCC1)N1CCSCC1 |
| InChI | InChI=1S/C17H24ClN3OS/c18-15-5-3-14(4-6-15)16(20-7-1-2-8-20)13-19-17(22)21-9-11-23-12-10-21/h3-6,16H,1-2,7-13H2,(H,19,22) |
| InChIKey | FOXNOHRYQDONCT-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.92 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |