About 4-[1,5-dimethyl-3-(trifluoromethyl)pyrazol-4-yl]-N-(oxan-4-ylmethyl)benzamide
4-[1,5-dimethyl-3-(trifluoromethyl)pyrazol-4-yl]-N-(oxan-4-ylmethyl)benzamide (PubChem CID 122563946) has the molecular formula C19H22F3N3O2
and a molecular weight of 381.40 g/mol. Its IUPAC name is 4-[1,5-dimethyl-3-(trifluoromethyl)pyrazol-4-yl]-N-(oxan-4-ylmethyl)benzamide.
Molecular Properties
| Compound Name | 4-[1,5-dimethyl-3-(trifluoromethyl)pyrazol-4-yl]-N-(oxan-4-ylmethyl)benzamide |
| PubChem CID | 122563946 |
| Molecular Formula | C19H22F3N3O2 |
| Molecular Weight | 381.40 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | 4-[1,5-dimethyl-3-(trifluoromethyl)pyrazol-4-yl]-N-(oxan-4-ylmethyl)benzamide |
| SMILES | Cc1c(-c2ccc(C(=O)NCC3CCOCC3)cc2)c(C(F)(F)F)nn1C |
| InChI | InChI=1S/C19H22F3N3O2/c1-12-16(17(19(20,21)22)24-25(12)2)14-3-5-15(6-4-14)18(26)23-11-13-7-9-27-10-8-13/h3-6,13H,7-11H2,1-2H3,(H,23,26) |
| InChIKey | PKYIVQFUZQWOMB-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.40 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[1,5-dimethyl-3-(trifluoromethyl)pyrazol-4-yl]-N-(oxan-4-ylmethyl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1,5-dimethyl-3-(trifluoromethyl)pyrazol-4-yl]-N-(oxan-4-ylmethyl)benzamide?
The IUPAC name of 4-[1,5-dimethyl-3-(trifluoromethyl)pyrazol-4-yl]-N-(oxan-4-ylmethyl)benzamide (CID 122563946) is 4-[1,5-dimethyl-3-(trifluoromethyl)pyrazol-4-yl]-N-(oxan-4-ylmethyl)benzamide.
What is the SMILES notation for 4-[1,5-dimethyl-3-(trifluoromethyl)pyrazol-4-yl]-N-(oxan-4-ylmethyl)benzamide?
The canonical SMILES for 4-[1,5-dimethyl-3-(trifluoromethyl)pyrazol-4-yl]-N-(oxan-4-ylmethyl)benzamide is Cc1c(-c2ccc(C(=O)NCC3CCOCC3)cc2)c(C(F)(F)F)nn1C.
What is the InChIKey of 4-[1,5-dimethyl-3-(trifluoromethyl)pyrazol-4-yl]-N-(oxan-4-ylmethyl)benzamide?
The InChIKey is PKYIVQFUZQWOMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22F3N3O2/c1-12-16(17(19(20,21)22)24-25(12)2)14-3-5-15(6-4-14)18(26)23-11-13-7-9-27-10-8-13/h3-6,13H,7-11H2,1-2H3,(H,23,26).
What are the key properties of 4-[1,5-dimethyl-3-(trifluoromethyl)pyrazol-4-yl]-N-(oxan-4-ylmethyl)benzamide?
4-[1,5-dimethyl-3-(trifluoromethyl)pyrazol-4-yl]-N-(oxan-4-ylmethyl)benzamide has a molecular weight of 381.40 g/mol, XLogP of 3.57, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1,5-dimethyl-3-(trifluoromethyl)pyrazol-4-yl]-N-(oxan-4-ylmethyl)benzamide is sourced from PubChem (CID 122563946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).