About 3-ethoxy-N-[(3R,4R)-4-(4-methylpiperazin-1-yl)oxolan-3-yl]propanamide
3-ethoxy-N-[(3R,4R)-4-(4-methylpiperazin-1-yl)oxolan-3-yl]propanamide (PubChem CID 122565060) has the molecular formula C14H27N3O3
and a molecular weight of 285.39 g/mol. Its IUPAC name is 3-ethoxy-N-[(3R,4R)-4-(4-methylpiperazin-1-yl)oxolan-3-yl]propanamide.
Molecular Properties
| Compound Name | 3-ethoxy-N-[(3R,4R)-4-(4-methylpiperazin-1-yl)oxolan-3-yl]propanamide |
| PubChem CID | 122565060 |
| Molecular Formula | C14H27N3O3 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.21 |
| IUPAC Name | 3-ethoxy-N-[(3R,4R)-4-(4-methylpiperazin-1-yl)oxolan-3-yl]propanamide |
| SMILES | CCOCCC(=O)N[C@H]1COC[C@@H]1N1CCN(C)CC1 |
| InChI | InChI=1S/C14H27N3O3/c1-3-19-9-4-14(18)15-12-10-20-11-13(12)17-7-5-16(2)6-8-17/h12-13H,3-11H2,1-2H3,(H,15,18)/t12-,13-/m0/s1 |
| InChIKey | NDBPSRDYLCCCRP-STQMWFEESA-N |
| XLogP | -0.46 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-ethoxy-N-[(3R,4R)-4-(4-methylpiperazin-1-yl)oxolan-3-yl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethoxy-N-[(3R,4R)-4-(4-methylpiperazin-1-yl)oxolan-3-yl]propanamide?
The IUPAC name of 3-ethoxy-N-[(3R,4R)-4-(4-methylpiperazin-1-yl)oxolan-3-yl]propanamide (CID 122565060) is 3-ethoxy-N-[(3R,4R)-4-(4-methylpiperazin-1-yl)oxolan-3-yl]propanamide.
What is the SMILES notation for 3-ethoxy-N-[(3R,4R)-4-(4-methylpiperazin-1-yl)oxolan-3-yl]propanamide?
The canonical SMILES for 3-ethoxy-N-[(3R,4R)-4-(4-methylpiperazin-1-yl)oxolan-3-yl]propanamide is CCOCCC(=O)N[C@H]1COC[C@@H]1N1CCN(C)CC1.
What is the InChIKey of 3-ethoxy-N-[(3R,4R)-4-(4-methylpiperazin-1-yl)oxolan-3-yl]propanamide?
The InChIKey is NDBPSRDYLCCCRP-STQMWFEESA-N. The full InChI is InChI=1S/C14H27N3O3/c1-3-19-9-4-14(18)15-12-10-20-11-13(12)17-7-5-16(2)6-8-17/h12-13H,3-11H2,1-2H3,(H,15,18)/t12-,13-/m0/s1.
What are the key properties of 3-ethoxy-N-[(3R,4R)-4-(4-methylpiperazin-1-yl)oxolan-3-yl]propanamide?
3-ethoxy-N-[(3R,4R)-4-(4-methylpiperazin-1-yl)oxolan-3-yl]propanamide has a molecular weight of 285.39 g/mol, XLogP of -0.46, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethoxy-N-[(3R,4R)-4-(4-methylpiperazin-1-yl)oxolan-3-yl]propanamide is sourced from PubChem (CID 122565060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).