C14H23N3O4S2 — CID 122565497
4-[hydroxy(thiophen-2-yl)methyl]-N-[2-(methylsulfamoyl)ethyl]piperidine-1-carboxamide (PubChem CID 122565497) has the molecular formula C14H23N3O4S2 and a molecular weight of 361.49 g/mol. Its IUPAC name is 4-[hydroxy(thiophen-2-yl)methyl]-N-[2-(methylsulfamoyl)ethyl]piperidine-1-carboxamide.
| Compound Name | 4-[hydroxy(thiophen-2-yl)methyl]-N-[2-(methylsulfamoyl)ethyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 122565497 |
| Molecular Formula | C14H23N3O4S2 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | 4-[hydroxy(thiophen-2-yl)methyl]-N-[2-(methylsulfamoyl)ethyl]piperidine-1-carboxamide |
| SMILES | CNS(=O)(=O)CCNC(=O)N1CCC(C(O)c2cccs2)CC1 |
| InChI | InChI=1S/C14H23N3O4S2/c1-15-23(20,21)10-6-16-14(19)17-7-4-11(5-8-17)13(18)12-3-2-9-22-12/h2-3,9,11,13,15,18H,4-8,10H2,1H3,(H,16,19) |
| InChIKey | DUXAQPMRCUMDIB-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |