About N-[(3-tert-butyl-1,2,4-oxadiazol-5-yl)methyl]-3-hydroxyazetidine-1-carboxamide
N-[(3-tert-butyl-1,2,4-oxadiazol-5-yl)methyl]-3-hydroxyazetidine-1-carboxamide (PubChem CID 122566180) has the molecular formula C11H18N4O3
and a molecular weight of 254.29 g/mol. Its IUPAC name is N-[(3-tert-butyl-1,2,4-oxadiazol-5-yl)methyl]-3-hydroxyazetidine-1-carboxamide.
Molecular Properties
| Compound Name | N-[(3-tert-butyl-1,2,4-oxadiazol-5-yl)methyl]-3-hydroxyazetidine-1-carboxamide |
| PubChem CID | 122566180 |
| Molecular Formula | C11H18N4O3 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | N-[(3-tert-butyl-1,2,4-oxadiazol-5-yl)methyl]-3-hydroxyazetidine-1-carboxamide |
| SMILES | CC(C)(C)c1noc(CNC(=O)N2CC(O)C2)n1 |
| InChI | InChI=1S/C11H18N4O3/c1-11(2,3)9-13-8(18-14-9)4-12-10(17)15-5-7(16)6-15/h7,16H,4-6H2,1-3H3,(H,12,17) |
| InChIKey | LJELCDTWYLIPGX-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[(3-tert-butyl-1,2,4-oxadiazol-5-yl)methyl]-3-hydroxyazetidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3-tert-butyl-1,2,4-oxadiazol-5-yl)methyl]-3-hydroxyazetidine-1-carboxamide?
The IUPAC name of N-[(3-tert-butyl-1,2,4-oxadiazol-5-yl)methyl]-3-hydroxyazetidine-1-carboxamide (CID 122566180) is N-[(3-tert-butyl-1,2,4-oxadiazol-5-yl)methyl]-3-hydroxyazetidine-1-carboxamide.
What is the SMILES notation for N-[(3-tert-butyl-1,2,4-oxadiazol-5-yl)methyl]-3-hydroxyazetidine-1-carboxamide?
The canonical SMILES for N-[(3-tert-butyl-1,2,4-oxadiazol-5-yl)methyl]-3-hydroxyazetidine-1-carboxamide is CC(C)(C)c1noc(CNC(=O)N2CC(O)C2)n1.
What is the InChIKey of N-[(3-tert-butyl-1,2,4-oxadiazol-5-yl)methyl]-3-hydroxyazetidine-1-carboxamide?
The InChIKey is LJELCDTWYLIPGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N4O3/c1-11(2,3)9-13-8(18-14-9)4-12-10(17)15-5-7(16)6-15/h7,16H,4-6H2,1-3H3,(H,12,17).
What are the key properties of N-[(3-tert-butyl-1,2,4-oxadiazol-5-yl)methyl]-3-hydroxyazetidine-1-carboxamide?
N-[(3-tert-butyl-1,2,4-oxadiazol-5-yl)methyl]-3-hydroxyazetidine-1-carboxamide has a molecular weight of 254.29 g/mol, XLogP of 0.25, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3-tert-butyl-1,2,4-oxadiazol-5-yl)methyl]-3-hydroxyazetidine-1-carboxamide is sourced from PubChem (CID 122566180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).