C20H26N6O — CID 122566237
4-(aminomethyl)-N-[3-(5-methyltetrazol-2-yl)-1-adamantyl]benzamide (PubChem CID 122566237) has the molecular formula C20H26N6O and a molecular weight of 366.47 g/mol. Its IUPAC name is 4-(aminomethyl)-N-[3-(5-methyltetrazol-2-yl)-1-adamantyl]benzamide.
| Compound Name | 4-(aminomethyl)-N-[3-(5-methyltetrazol-2-yl)-1-adamantyl]benzamide |
|---|---|
| PubChem CID | 122566237 |
| Molecular Formula | C20H26N6O |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | 4-(aminomethyl)-N-[3-(5-methyltetrazol-2-yl)-1-adamantyl]benzamide |
| SMILES | Cc1nnn(C23CC4CC(CC(NC(=O)c5ccc(CN)cc5)(C4)C2)C3)n1 |
| InChI | InChI=1S/C20H26N6O/c1-13-23-25-26(24-13)20-9-15-6-16(10-20)8-19(7-15,12-20)22-18(27)17-4-2-14(11-21)3-5-17/h2-5,15-16H,6-12,21H2,1H3,(H,22,27) |
| InChIKey | TVUVPQXZFNMQEJ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |