C13H23N5O3S — CID 122566915
1-cyclopropyl-3-[2-(dimethylsulfamoyl)ethyl]-1-[(1-methylpyrazol-4-yl)methyl]urea (PubChem CID 122566915) has the molecular formula C13H23N5O3S and a molecular weight of 329.43 g/mol. Its IUPAC name is 1-cyclopropyl-3-[2-(dimethylsulfamoyl)ethyl]-1-[(1-methylpyrazol-4-yl)methyl]urea.
| Compound Name | 1-cyclopropyl-3-[2-(dimethylsulfamoyl)ethyl]-1-[(1-methylpyrazol-4-yl)methyl]urea |
|---|---|
| PubChem CID | 122566915 |
| Molecular Formula | C13H23N5O3S |
| Molecular Weight | 329.43 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | 1-cyclopropyl-3-[2-(dimethylsulfamoyl)ethyl]-1-[(1-methylpyrazol-4-yl)methyl]urea |
| SMILES | CN(C)S(=O)(=O)CCNC(=O)N(Cc1cnn(C)c1)C1CC1 |
| InChI | InChI=1S/C13H23N5O3S/c1-16(2)22(20,21)7-6-14-13(19)18(12-4-5-12)10-11-8-15-17(3)9-11/h8-9,12H,4-7,10H2,1-3H3,(H,14,19) |
| InChIKey | LRCPRCGASIGKLY-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 87.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.43 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |